C12H6F19NO4S — CID 141495128
ethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)acetate (PubChem CID 141495128) has the molecular formula C12H6F19NO4S and a molecular weight of 621.21 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)acetate |
|---|---|
| PubChem CID | 141495128 |
| Molecular Formula | C12H6F19NO4S |
| Molecular Weight | 621.21 g/mol |
| Exact Mass | 620.97 |
| IUPAC Name | ethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)acetate |
| SMILES | CCOC(=O)C(F)(F)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F19NO4S/c1-2-36-3(33)4(13,14)32-37(34,35)12(30,31)10(25,26)8(21,22)6(17,18)5(15,16)7(19,20)9(23,24)11(27,28)29/h32H,2H2,1H3 |
| InChIKey | KCXYNXNEYSRJGZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|