C10H5F15O2 — CID 174510530
ethyl 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-2-(trifluoromethyl)heptanoate (PubChem CID 174510530) has the molecular formula C10H5F15O2 and a molecular weight of 442.12 g/mol. Its IUPAC name is ethyl 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-2-(trifluoromethyl)heptanoate.
| Compound Name | ethyl 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-2-(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 174510530 |
| Molecular Formula | C10H5F15O2 |
| Molecular Weight | 442.12 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | ethyl 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-2-(trifluoromethyl)heptanoate |
| SMILES | CCOC(=O)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15O2/c1-2-27-3(26)4(11,9(20,21)22)5(12,13)6(14,15)7(16,17)8(18,19)10(23,24)25/h2H2,1H3 |
| InChIKey | DGFGELCFVZVQSD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.12 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|