C20H14F22O4 — CID 175429588
ethyl 3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate;ethyl 3,4,4,5,5,5-hexafluoro-2-methylidene-3-(trifluoromethyl)pentanoate (PubChem CID 175429588) has the molecular formula C20H14F22O4 and a molecular weight of 736.28 g/mol. Its IUPAC name is ethyl 3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate;ethyl 3,4,4,5,5,5-hexafluoro-2-methylidene-3-(trifluoromethyl)pentanoate.
| Compound Name | ethyl 3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate;ethyl 3,4,4,5,5,5-hexafluoro-2-methylidene-3-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 175429588 |
| Molecular Formula | C20H14F22O4 |
| Molecular Weight | 736.28 g/mol |
| Exact Mass | 736.05 |
| IUPAC Name | ethyl 3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate;ethyl 3,4,4,5,5,5-hexafluoro-2-methylidene-3-(trifluoromethyl)pentanoate |
| SMILES | C=C(C(=O)OCC)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.C=C(C(=O)OCC)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F13O2.C9H7F9O2/c1-3-26-5(25)4(2)6(12,10(19,20)21)7(13,14)8(15,16)9(17,18)11(22,23)24;1-3-20-5(19)4(2)6(10,8(13,14)15)7(11,12)9(16,17)18/h2-3H2,1H3;2-3H2,1H3 |
| InChIKey | JFQHTSBIHQOLQU-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.28 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|