C8H8F6O3 — CID 15040536
ethyl 4,4,4-trifluoro-3-hydroxy-2-methylidene-3-(trifluoromethyl)butanoate (PubChem CID 15040536) has the molecular formula C8H8F6O3 and a molecular weight of 266.14 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-hydroxy-2-methylidene-3-(trifluoromethyl)butanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-hydroxy-2-methylidene-3-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 15040536 |
| Molecular Formula | C8H8F6O3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-hydroxy-2-methylidene-3-(trifluoromethyl)butanoate |
| SMILES | C=C(C(=O)OCC)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6O3/c1-3-17-5(15)4(2)6(16,7(9,10)11)8(12,13)14/h16H,2-3H2,1H3 |
| InChIKey | PMHBUHIZSGSMQJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|