C11H17F3O3 — CID 162537757
ethyl 2-hydroxy-5-methyl-4-methylidene-2-(trifluoromethyl)hexanoate (PubChem CID 162537757) has the molecular formula C11H17F3O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is ethyl 2-hydroxy-5-methyl-4-methylidene-2-(trifluoromethyl)hexanoate.
| Compound Name | ethyl 2-hydroxy-5-methyl-4-methylidene-2-(trifluoromethyl)hexanoate |
|---|---|
| PubChem CID | 162537757 |
| Molecular Formula | C11H17F3O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethyl 2-hydroxy-5-methyl-4-methylidene-2-(trifluoromethyl)hexanoate |
| SMILES | C=C(CC(O)(C(=O)OCC)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H17F3O3/c1-5-17-9(15)10(16,11(12,13)14)6-8(4)7(2)3/h7,16H,4-6H2,1-3H3 |
| InChIKey | ZXKFDKFSGMPCCA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|