C13H21F3O3 — CID 134964588
ethyl (2S)-2-hydroxy-6,6-dimethyl-4-methylidene-2-(trifluoromethyl)heptanoate (PubChem CID 134964588) has the molecular formula C13H21F3O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxy-6,6-dimethyl-4-methylidene-2-(trifluoromethyl)heptanoate.
| Compound Name | ethyl (2S)-2-hydroxy-6,6-dimethyl-4-methylidene-2-(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 134964588 |
| Molecular Formula | C13H21F3O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | ethyl (2S)-2-hydroxy-6,6-dimethyl-4-methylidene-2-(trifluoromethyl)heptanoate |
| SMILES | C=C(CC(C)(C)C)C[C@](O)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O3/c1-6-19-10(17)12(18,13(14,15)16)8-9(2)7-11(3,4)5/h18H,2,6-8H2,1,3-5H3/t12-/m0/s1 |
| InChIKey | JRRURCBGKMBUBE-LBPRGKRZSA-N |
| XLogP | 3.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|