C16H19F3O3 — CID 102589699
ethyl (2R)-4-(4-ethylphenyl)-2-hydroxy-2-(trifluoromethyl)pent-4-enoate (PubChem CID 102589699) has the molecular formula C16H19F3O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is ethyl (2R)-4-(4-ethylphenyl)-2-hydroxy-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | ethyl (2R)-4-(4-ethylphenyl)-2-hydroxy-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 102589699 |
| Molecular Formula | C16H19F3O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl (2R)-4-(4-ethylphenyl)-2-hydroxy-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=C(C[C@@](O)(C(=O)OCC)C(F)(F)F)c1ccc(CC)cc1 |
| InChI | InChI=1S/C16H19F3O3/c1-4-12-6-8-13(9-7-12)11(3)10-15(21,16(17,18)19)14(20)22-5-2/h6-9,21H,3-5,10H2,1-2H3/t15-/m1/s1 |
| InChIKey | XXXLPFWEUCIGOF-OAHLLOKOSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |