C8H11F3O3 — CID 26985843
methyl (2R)-2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate (PubChem CID 26985843) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is methyl (2R)-2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | methyl (2R)-2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 26985843 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | methyl (2R)-2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=C(C)C[C@@](O)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O3/c1-5(2)4-7(13,6(12)14-3)8(9,10)11/h13H,1,4H2,2-3H3/t7-/m1/s1 |
| InChIKey | HMDKXEVTOYZRSE-SSDOTTSWSA-N |
| XLogP | 1.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|