C14H15F3O4 — CID 102173229
methyl (2R)-2-hydroxy-4-(4-methoxyphenyl)-2-(trifluoromethyl)pent-4-enoate (PubChem CID 102173229) has the molecular formula C14H15F3O4 and a molecular weight of 304.26 g/mol. Its IUPAC name is methyl (2R)-2-hydroxy-4-(4-methoxyphenyl)-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | methyl (2R)-2-hydroxy-4-(4-methoxyphenyl)-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 102173229 |
| Molecular Formula | C14H15F3O4 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | methyl (2R)-2-hydroxy-4-(4-methoxyphenyl)-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=C(C[C@@](O)(C(=O)OC)C(F)(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H15F3O4/c1-9(10-4-6-11(20-2)7-5-10)8-13(19,12(18)21-3)14(15,16)17/h4-7,19H,1,8H2,2-3H3/t13-/m1/s1 |
| InChIKey | UKRAJSHOYKMRDQ-CYBMUJFWSA-N |
| XLogP | 2.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |