C14H16F3NO3 — CID 101266831
methyl 2-(4-methoxyanilino)-2-(trifluoromethyl)pent-4-enoate (PubChem CID 101266831) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is methyl 2-(4-methoxyanilino)-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | methyl 2-(4-methoxyanilino)-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 101266831 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl 2-(4-methoxyanilino)-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=CCC(Nc1ccc(OC)cc1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO3/c1-4-9-13(12(19)21-3,14(15,16)17)18-10-5-7-11(20-2)8-6-10/h4-8,18H,1,9H2,2-3H3 |
| InChIKey | NWPXBAAUYZUARR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|