C9H8F3NO3 — CID 87301067
(4-methoxyanilino) 2,2,2-trifluoroacetate (PubChem CID 87301067) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is (4-methoxyanilino) 2,2,2-trifluoroacetate.
| Compound Name | (4-methoxyanilino) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87301067 |
| Molecular Formula | C9H8F3NO3 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (4-methoxyanilino) 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(NOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3NO3/c1-15-7-4-2-6(3-5-7)13-16-8(14)9(10,11)12/h2-5,13H,1H3 |
| InChIKey | AJJUSKUKUKKFOT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|