C10H10F3NO3 — CID 87974565
[(4-methoxyphenyl)methylamino] 2,2,2-trifluoroacetate (PubChem CID 87974565) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is [(4-methoxyphenyl)methylamino] 2,2,2-trifluoroacetate.
| Compound Name | [(4-methoxyphenyl)methylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87974565 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [(4-methoxyphenyl)methylamino] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(CNOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO3/c1-16-8-4-2-7(3-5-8)6-14-17-9(15)10(11,12)13/h2-5,14H,6H2,1H3 |
| InChIKey | SGCAFJKWHSZZQZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|