C12H13F3O2S — CID 127052821
1,1,1-trifluoro-3-[2-(4-methoxyphenyl)ethylsulfanyl]propan-2-one (PubChem CID 127052821) has the molecular formula C12H13F3O2S and a molecular weight of 278.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-(4-methoxyphenyl)ethylsulfanyl]propan-2-one.
| Compound Name | 1,1,1-trifluoro-3-[2-(4-methoxyphenyl)ethylsulfanyl]propan-2-one |
|---|---|
| PubChem CID | 127052821 |
| Molecular Formula | C12H13F3O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-(4-methoxyphenyl)ethylsulfanyl]propan-2-one |
| SMILES | COc1ccc(CCSCC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O2S/c1-17-10-4-2-9(3-5-10)6-7-18-8-11(16)12(13,14)15/h2-5H,6-8H2,1H3 |
| InChIKey | UTAIXHSCVMKBTQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|