C23H32N2O3S2 — CID 46899391
2-[2-[2-(4-methoxyphenyl)ethylsulfanyl]ethylamino]-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 46899391) has the molecular formula C23H32N2O3S2 and a molecular weight of 448.65 g/mol. Its IUPAC name is 2-[2-[2-(4-methoxyphenyl)ethylsulfanyl]ethylamino]-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[2-[2-(4-methoxyphenyl)ethylsulfanyl]ethylamino]-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 46899391 |
| Molecular Formula | C23H32N2O3S2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-[2-[2-(4-methoxyphenyl)ethylsulfanyl]ethylamino]-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | COc1ccc(CCSCCNCC(=O)NCCSCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O3S2/c1-27-21-7-3-19(4-8-21)11-14-29-15-12-24-17-23(26)25-13-16-30-18-20-5-9-22(28-2)10-6-20/h3-10,24H,11-18H2,1-2H3,(H,25,26) |
| InChIKey | UQBGVKUZXFDSTB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|