C11H15NO2S — CID 53279533
2-[(4-methoxyphenyl)methylsulfanyl]-N-methylacetamide (PubChem CID 53279533) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylsulfanyl]-N-methylacetamide.
| Compound Name | 2-[(4-methoxyphenyl)methylsulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 53279533 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylsulfanyl]-N-methylacetamide |
| SMILES | CNC(=O)CSCc1ccc(OC)cc1 |
| InChI | InChI=1S/C11H15NO2S/c1-12-11(13)8-15-7-9-3-5-10(14-2)6-4-9/h3-6H,7-8H2,1-2H3,(H,12,13) |
| InChIKey | XVMLEDWIZJJFJL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |