C11H14N2OS2 — CID 82178528
2-[(4-carbamothioylphenyl)methylsulfanyl]-N-methylacetamide (PubChem CID 82178528) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[(4-carbamothioylphenyl)methylsulfanyl]-N-methylacetamide.
| Compound Name | 2-[(4-carbamothioylphenyl)methylsulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 82178528 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-[(4-carbamothioylphenyl)methylsulfanyl]-N-methylacetamide |
| SMILES | CNC(=O)CSCc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C11H14N2OS2/c1-13-10(14)7-16-6-8-2-4-9(5-3-8)11(12)15/h2-5H,6-7H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | CEZIFXJYKLUTEI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|