C16H15NO2S2 — CID 94804925
3-[(4-carbamothioylphenyl)methylsulfanylmethyl]benzoic acid (PubChem CID 94804925) has the molecular formula C16H15NO2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 3-[(4-carbamothioylphenyl)methylsulfanylmethyl]benzoic acid.
| Compound Name | 3-[(4-carbamothioylphenyl)methylsulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 94804925 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-[(4-carbamothioylphenyl)methylsulfanylmethyl]benzoic acid |
| SMILES | NC(=S)c1ccc(CSCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H15NO2S2/c17-15(20)13-6-4-11(5-7-13)9-21-10-12-2-1-3-14(8-12)16(18)19/h1-8H,9-10H2,(H2,17,20)(H,18,19) |
| InChIKey | VZCXEPMZUDSSTN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|