C12H15NO2S2 — CID 82178711
4-[(3-carbamothioylphenyl)methylsulfanyl]butanoic acid (PubChem CID 82178711) has the molecular formula C12H15NO2S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-[(3-carbamothioylphenyl)methylsulfanyl]butanoic acid.
| Compound Name | 4-[(3-carbamothioylphenyl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 82178711 |
| Molecular Formula | C12H15NO2S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-[(3-carbamothioylphenyl)methylsulfanyl]butanoic acid |
| SMILES | NC(=S)c1cccc(CSCCCC(=O)O)c1 |
| InChI | InChI=1S/C12H15NO2S2/c13-12(16)10-4-1-3-9(7-10)8-17-6-2-5-11(14)15/h1,3-4,7H,2,5-6,8H2,(H2,13,16)(H,14,15) |
| InChIKey | NYQBPDAEVIHOST-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|