C11H17N3OS — CID 66219490
3-(3-aminopropylsulfanylmethyl)benzohydrazide (PubChem CID 66219490) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-(3-aminopropylsulfanylmethyl)benzohydrazide.
| Compound Name | 3-(3-aminopropylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 66219490 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-(3-aminopropylsulfanylmethyl)benzohydrazide |
| SMILES | NCCCSCc1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C11H17N3OS/c12-5-2-6-16-8-9-3-1-4-10(7-9)11(15)14-13/h1,3-4,7H,2,5-6,8,12-13H2,(H,14,15) |
| InChIKey | MHQKWKRPWZNTSF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|