C17H16F3NO2S — CID 989309
2-[(4-methoxyphenyl)methylsulfanyl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 989309) has the molecular formula C17H16F3NO2S and a molecular weight of 355.38 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylsulfanyl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4-methoxyphenyl)methylsulfanyl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 989309 |
| Molecular Formula | C17H16F3NO2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylsulfanyl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H16F3NO2S/c1-23-15-8-2-12(3-9-15)10-24-11-16(22)21-14-6-4-13(5-7-14)17(18,19)20/h2-9H,10-11H2,1H3,(H,21,22) |
| InChIKey | SFVJXNXREQULTK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |