C19H20ClNO4S — CID 7429524
2-(4-methoxyphenyl)ethyl 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 7429524) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | 2-(4-methoxyphenyl)ethyl 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 7429524 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | COc1ccc(CCOC(=O)CSCC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClNO4S/c1-24-17-8-2-14(3-9-17)10-11-25-19(23)13-26-12-18(22)21-16-6-4-15(20)5-7-16/h2-9H,10-13H2,1H3,(H,21,22) |
| InChIKey | IGXGCDIDSHWOOE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |