C20H22O5 — CID 122530743
2-[2-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)propanedioic acid (PubChem CID 122530743) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)propanedioic acid.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)propanedioic acid |
|---|---|
| PubChem CID | 122530743 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl]-2-(2-phenylethyl)propanedioic acid |
| SMILES | COc1ccc(CCC(CCc2ccccc2)(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H22O5/c1-25-17-9-7-16(8-10-17)12-14-20(18(21)22,19(23)24)13-11-15-5-3-2-4-6-15/h2-10H,11-14H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | KHEZHSBHAIUGBR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|