C19H20O5 — CID 58403888
2-[(4-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]propanedioic acid (PubChem CID 58403888) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]propanedioic acid.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 58403888 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]propanedioic acid |
| SMILES | COc1ccc(CC(Cc2ccc(C)cc2)(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C19H20O5/c1-13-3-5-14(6-4-13)11-19(17(20)21,18(22)23)12-15-7-9-16(24-2)10-8-15/h3-10H,11-12H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | BGVRBJNHPCGDET-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|