C17H19F6NO4 — CID 160974757
1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanamide (PubChem CID 160974757) has the molecular formula C17H19F6NO4 and a molecular weight of 415.33 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanamide.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 160974757 |
| Molecular Formula | C17H19F6NO4 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-[(4-methoxyphenyl)methyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(CNC(=O)C(C)(C)C)cc1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H19NO2.C4F6O2/c1-13(2,3)12(15)14-9-10-5-7-11(16-4)8-6-10;5-3(6,7)1(11)2(12)4(8,9)10/h5-8H,9H2,1-4H3,(H,14,15); |
| InChIKey | SYSFFVYQXBSSMP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|