C12H17F3N2O3 — CID 173146876
1-ethyl-2-(4-methoxyphenyl)-1-methylhydrazine;2,2,2-trifluoroacetic acid (PubChem CID 173146876) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 1-ethyl-2-(4-methoxyphenyl)-1-methylhydrazine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-ethyl-2-(4-methoxyphenyl)-1-methylhydrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173146876 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-ethyl-2-(4-methoxyphenyl)-1-methylhydrazine;2,2,2-trifluoroacetic acid |
| SMILES | CCN(C)Nc1ccc(OC)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H16N2O.C2HF3O2/c1-4-12(2)11-9-5-7-10(13-3)8-6-9;3-2(4,5)1(6)7/h5-8,11H,4H2,1-3H3;(H,6,7) |
| InChIKey | FYQYSDDGSPMWMV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|