C10H11FO4 — CID 178069043
2-fluoro-3-hydroxy-2-(4-methoxyphenyl)propanoic acid (PubChem CID 178069043) has the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. Its IUPAC name is 2-fluoro-3-hydroxy-2-(4-methoxyphenyl)propanoic acid.
| Compound Name | 2-fluoro-3-hydroxy-2-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 178069043 |
| Molecular Formula | C10H11FO4 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-fluoro-3-hydroxy-2-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(F)(CO)C(=O)O)cc1 |
| InChI | InChI=1S/C10H11FO4/c1-15-8-4-2-7(3-5-8)10(11,6-12)9(13)14/h2-5,12H,6H2,1H3,(H,13,14) |
| InChIKey | NAPYDAMAJQAIGR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |