C15H22O4 — CID 69226482
2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid (PubChem CID 69226482) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid.
| Compound Name | 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid |
|---|---|
| PubChem CID | 69226482 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid |
| SMILES | CCCC(C)(c1ccc(OC)cc1)C(C)(O)C(=O)O |
| InChI | InChI=1S/C15H22O4/c1-5-10-14(2,15(3,18)13(16)17)11-6-8-12(19-4)9-7-11/h6-9,18H,5,10H2,1-4H3,(H,16,17) |
| InChIKey | TXEWUYMASSOBHJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |