2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid

C15H22O4 — CID 69226482

IUPAC2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid
SMILESCCCC(C)(c1ccc(OC)cc1)C(C)(O)C(=O)O
InChIInChI=1S/C15H22O4/c1-5-10-14(2,15(3,18)13(16)17)11-6-8-12(19-4)9-7-11/h6-9,18H,5,10H2,1-4H3,(H,16,17)
InChIKeyTXEWUYMASSOBHJ-UHFFFAOYSA-N
MW266.34 g/mol
LogP2.59
Rot. Bonds6

About 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid

2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid (PubChem CID 69226482) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid.

Molecular Properties

Compound Name2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid
PubChem CID69226482
Molecular FormulaC15H22O4
Molecular Weight266.34 g/mol
Exact Mass266.15
IUPAC Name2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid
SMILESCCCC(C)(c1ccc(OC)cc1)C(C)(O)C(=O)O
InChIInChI=1S/C15H22O4/c1-5-10-14(2,15(3,18)13(16)17)11-6-8-12(19-4)9-7-11/h6-9,18H,5,10H2,1-4H3,(H,16,17)
InChIKeyTXEWUYMASSOBHJ-UHFFFAOYSA-N
XLogP2.59
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 52.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid?
The IUPAC name of 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid (CID 69226482) is 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid.
What is the SMILES notation for 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid?
The canonical SMILES for 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid is CCCC(C)(c1ccc(OC)cc1)C(C)(O)C(=O)O.
What is the InChIKey of 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid?
The InChIKey is TXEWUYMASSOBHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-5-10-14(2,15(3,18)13(16)17)11-6-8-12(19-4)9-7-11/h6-9,18H,5,10H2,1-4H3,(H,16,17).
What are the key properties of 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid?
2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid has a molecular weight of 266.34 g/mol, XLogP of 2.59, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-(4-methoxyphenyl)-2,3-dimethylhexanoic acid is sourced from PubChem (CID 69226482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).