C33H32O4 — CID 144556494
[4-[4-(4-methoxybenzoyl)phenoxy]phenyl]-[4-(2-methylpentan-2-yl)phenyl]methanone (PubChem CID 144556494) has the molecular formula C33H32O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is [4-[4-(4-methoxybenzoyl)phenoxy]phenyl]-[4-(2-methylpentan-2-yl)phenyl]methanone.
| Compound Name | [4-[4-(4-methoxybenzoyl)phenoxy]phenyl]-[4-(2-methylpentan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 144556494 |
| Molecular Formula | C33H32O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | [4-[4-(4-methoxybenzoyl)phenoxy]phenyl]-[4-(2-methylpentan-2-yl)phenyl]methanone |
| SMILES | CCCC(C)(C)c1ccc(C(=O)c2ccc(Oc3ccc(C(=O)c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H32O4/c1-5-22-33(2,3)27-14-6-23(7-15-27)31(34)25-10-18-29(19-11-25)37-30-20-12-26(13-21-30)32(35)24-8-16-28(36-4)17-9-24/h6-21H,5,22H2,1-4H3 |
| InChIKey | FUKCURJMHUSQQF-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |