C41H35O7P — CID 58750882
[4-[4-[4-[1-(4-methoxyphenyl)-1-[4-(4-methylphenoxy)phenyl]ethyl]phenoxy]benzoyl]phenyl]phosphonic acid (PubChem CID 58750882) has the molecular formula C41H35O7P and a molecular weight of 670.70 g/mol. Its IUPAC name is [4-[4-[4-[1-(4-methoxyphenyl)-1-[4-(4-methylphenoxy)phenyl]ethyl]phenoxy]benzoyl]phenyl]phosphonic acid.
| Compound Name | [4-[4-[4-[1-(4-methoxyphenyl)-1-[4-(4-methylphenoxy)phenyl]ethyl]phenoxy]benzoyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 58750882 |
| Molecular Formula | C41H35O7P |
| Molecular Weight | 670.70 g/mol |
| Exact Mass | 670.21 |
| IUPAC Name | [4-[4-[4-[1-(4-methoxyphenyl)-1-[4-(4-methylphenoxy)phenyl]ethyl]phenoxy]benzoyl]phenyl]phosphonic acid |
| SMILES | COc1ccc(C(C)(c2ccc(Oc3ccc(C)cc3)cc2)c2ccc(Oc3ccc(C(=O)c4ccc(P(=O)(O)O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H35O7P/c1-28-4-16-35(17-5-28)47-37-22-12-32(13-23-37)41(2,31-10-20-34(46-3)21-11-31)33-14-24-38(25-15-33)48-36-18-6-29(7-19-36)40(42)30-8-26-39(27-9-30)49(43,44)45/h4-27H,1-3H3,(H2,43,44,45) |
| InChIKey | KMCRLDYDKHXLFG-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.70 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|