C33H27O7P — CID 58750868
[4-[4-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]benzoyl]phenyl]phosphonic acid (PubChem CID 58750868) has the molecular formula C33H27O7P and a molecular weight of 566.55 g/mol. Its IUPAC name is [4-[4-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]benzoyl]phenyl]phosphonic acid.
| Compound Name | [4-[4-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]benzoyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 58750868 |
| Molecular Formula | C33H27O7P |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | [4-[4-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]benzoyl]phenyl]phosphonic acid |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(Oc2ccc(C(=O)c3ccc(P(=O)(O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H27O7P/c1-33(24-6-12-27(34)13-7-24,25-8-14-28(35)15-9-25)26-10-18-30(19-11-26)40-29-16-2-22(3-17-29)32(36)23-4-20-31(21-5-23)41(37,38)39/h2-21,34-35H,1H3,(H2,37,38,39) |
| InChIKey | BANWFQLHZJIFJV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|