C10H11F2NO3 — CID 139665561
2,2-difluoro-3-hydroxy-N-(4-methoxyphenyl)propanamide (PubChem CID 139665561) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-N-(4-methoxyphenyl)propanamide.
| Compound Name | 2,2-difluoro-3-hydroxy-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 139665561 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)C(F)(F)CO)cc1 |
| InChI | InChI=1S/C10H11F2NO3/c1-16-8-4-2-7(3-5-8)13-9(15)10(11,12)6-14/h2-5,14H,6H2,1H3,(H,13,15) |
| InChIKey | RGABXMCSAZEZIP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |