C20H20F3NO3 — CID 11639482
methyl (E)-2-(4-methoxyanilino)-5-phenyl-2-(trifluoromethyl)pent-4-enoate (PubChem CID 11639482) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is methyl (E)-2-(4-methoxyanilino)-5-phenyl-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | methyl (E)-2-(4-methoxyanilino)-5-phenyl-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 11639482 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | methyl (E)-2-(4-methoxyanilino)-5-phenyl-2-(trifluoromethyl)pent-4-enoate |
| SMILES | COC(=O)C(C/C=C/c1ccccc1)(Nc1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H20F3NO3/c1-26-17-12-10-16(11-13-17)24-19(18(25)27-2,20(21,22)23)14-6-9-15-7-4-3-5-8-15/h3-13,24H,14H2,1-2H3/b9-6+ |
| InChIKey | DUEOUCOOBGXWHX-RMKNXTFCSA-N |
| XLogP | 4.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|