C21H25NO3 — CID 146162567
ethyl (E,2S)-2-amino-2-benzyl-5-(4-methoxyphenyl)pent-4-enoate (PubChem CID 146162567) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl (E,2S)-2-amino-2-benzyl-5-(4-methoxyphenyl)pent-4-enoate.
| Compound Name | ethyl (E,2S)-2-amino-2-benzyl-5-(4-methoxyphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 146162567 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | ethyl (E,2S)-2-amino-2-benzyl-5-(4-methoxyphenyl)pent-4-enoate |
| SMILES | CCOC(=O)[C@](N)(C/C=C/c1ccc(OC)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-3-25-20(23)21(22,16-18-8-5-4-6-9-18)15-7-10-17-11-13-19(24-2)14-12-17/h4-14H,3,15-16,22H2,1-2H3/b10-7+/t21-/m0/s1 |
| InChIKey | XSNCKUJYFWNMPT-CLNPQZTCSA-N |
| XLogP | 3.60 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |