C19H22O5S — CID 10948439
ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-phenylpropanoate (PubChem CID 10948439) has the molecular formula C19H22O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-phenylpropanoate.
| Compound Name | ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 10948439 |
| Molecular Formula | C19H22O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-phenylpropanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccccc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22O5S/c1-4-24-18(20)19(2,14-15-8-6-5-7-9-15)25(21,22)17-12-10-16(23-3)11-13-17/h5-13H,4,14H2,1-3H3 |
| InChIKey | HRBLYZSWZKHYRS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |