C19H20O5S — CID 124673623
(E,2R)-2-(4-methoxyphenyl)sulfonyl-2-methyl-5-phenylpent-3-enoic acid (PubChem CID 124673623) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is (E,2R)-2-(4-methoxyphenyl)sulfonyl-2-methyl-5-phenylpent-3-enoic acid.
| Compound Name | (E,2R)-2-(4-methoxyphenyl)sulfonyl-2-methyl-5-phenylpent-3-enoic acid |
|---|---|
| PubChem CID | 124673623 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (E,2R)-2-(4-methoxyphenyl)sulfonyl-2-methyl-5-phenylpent-3-enoic acid |
| SMILES | COc1ccc(S(=O)(=O)[C@](C)(/C=C/Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H20O5S/c1-19(18(20)21,14-6-9-15-7-4-3-5-8-15)25(22,23)17-12-10-16(24-2)11-13-17/h3-8,10-14H,9H2,1-2H3,(H,20,21)/b14-6+/t19-/m1/s1 |
| InChIKey | ZAPANXZRDASINC-HOWNQORCSA-N |
| XLogP | 3.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|