C25H23NO5S — CID 70127812
2-amino-2-[4-(4-methoxyphenyl)phenyl]sulfonyl-6-phenylhex-4-ynoic acid (PubChem CID 70127812) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-amino-2-[4-(4-methoxyphenyl)phenyl]sulfonyl-6-phenylhex-4-ynoic acid.
| Compound Name | 2-amino-2-[4-(4-methoxyphenyl)phenyl]sulfonyl-6-phenylhex-4-ynoic acid |
|---|---|
| PubChem CID | 70127812 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-amino-2-[4-(4-methoxyphenyl)phenyl]sulfonyl-6-phenylhex-4-ynoic acid |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)C(N)(CC#CCc3ccccc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H23NO5S/c1-31-22-14-10-20(11-15-22)21-12-16-23(17-13-21)32(29,30)25(26,24(27)28)18-6-5-9-19-7-3-2-4-8-19/h2-4,7-8,10-17H,9,18,26H2,1H3,(H,27,28) |
| InChIKey | OQXCQAWTAPPZQV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|