C17H20N2O5S — CID 67707570
3-amino-3-hydroxy-2-(4-methoxyphenyl)sulfonyl-4-phenylbutanamide (PubChem CID 67707570) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-amino-3-hydroxy-2-(4-methoxyphenyl)sulfonyl-4-phenylbutanamide.
| Compound Name | 3-amino-3-hydroxy-2-(4-methoxyphenyl)sulfonyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 67707570 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-amino-3-hydroxy-2-(4-methoxyphenyl)sulfonyl-4-phenylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)C(C(N)=O)C(N)(O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-24-13-7-9-14(10-8-13)25(22,23)15(16(18)20)17(19,21)11-12-5-3-2-4-6-12/h2-10,15,21H,11,19H2,1H3,(H2,18,20) |
| InChIKey | YDJKRHGLLGAWDI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|