C20H23NO5 — CID 67712155
but-2-enedioic acid;2-(4-methoxyphenyl)-1-phenylpropan-2-amine (PubChem CID 67712155) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is but-2-enedioic acid;2-(4-methoxyphenyl)-1-phenylpropan-2-amine.
| Compound Name | but-2-enedioic acid;2-(4-methoxyphenyl)-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 67712155 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | but-2-enedioic acid;2-(4-methoxyphenyl)-1-phenylpropan-2-amine |
| SMILES | COc1ccc(C(C)(N)Cc2ccccc2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H19NO.C4H4O4/c1-16(17,12-13-6-4-3-5-7-13)14-8-10-15(18-2)11-9-14;5-3(6)1-2-4(7)8/h3-11H,12,17H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HCWJAWQALOWWTM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|