C19H21NO4 — CID 70041111
(Z)-but-2-enedioic acid;1,2-diphenylpropan-2-amine (PubChem CID 70041111) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1,2-diphenylpropan-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;1,2-diphenylpropan-2-amine |
|---|---|
| PubChem CID | 70041111 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;1,2-diphenylpropan-2-amine |
| SMILES | CC(N)(Cc1ccccc1)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H17N.C4H4O4/c1-15(16,14-10-6-3-7-11-14)12-13-8-4-2-5-9-13;5-3(6)1-2-4(7)8/h2-11H,12,16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KEKYGKUCIIBHQL-BTJKTKAUSA-N |
| XLogP | 2.82 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|