C10H17NO4S — CID 174984746
2-methyl-1-phenylpropan-2-amine;sulfuric acid (PubChem CID 174984746) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-methyl-1-phenylpropan-2-amine;sulfuric acid.
| Compound Name | 2-methyl-1-phenylpropan-2-amine;sulfuric acid |
|---|---|
| PubChem CID | 174984746 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-methyl-1-phenylpropan-2-amine;sulfuric acid |
| SMILES | CC(C)(N)Cc1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C10H15N.H2O4S/c1-10(2,11)8-9-6-4-3-5-7-9;1-5(2,3)4/h3-7H,8,11H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | PHWSSZQXPSJXID-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|