C10H16N2O2S — CID 130155148
4-(2-amino-2-methylpropyl)benzenesulfonamide (PubChem CID 130155148) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-(2-amino-2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-(2-amino-2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 130155148 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(2-amino-2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)(N)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H16N2O2S/c1-10(2,11)7-8-3-5-9(6-4-8)15(12,13)14/h3-6H,7,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | NMRHXDAGEQCYOT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |