C15H18N2O2S — CID 834409
4-[(4-ethylphenyl)methylamino]benzenesulfonamide (PubChem CID 834409) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)methylamino]benzenesulfonamide.
| Compound Name | 4-[(4-ethylphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 834409 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[(4-ethylphenyl)methylamino]benzenesulfonamide |
| SMILES | CCc1ccc(CNc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H18N2O2S/c1-2-12-3-5-13(6-4-12)11-17-14-7-9-15(10-8-14)20(16,18)19/h3-10,17H,2,11H2,1H3,(H2,16,18,19) |
| InChIKey | JMAMKDRLJUPJBE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |