C14H17N3O4S2 — CID 167881522
3-methyl-5-[(4-sulfamoylphenyl)methylamino]benzenesulfonamide (PubChem CID 167881522) has the molecular formula C14H17N3O4S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-methyl-5-[(4-sulfamoylphenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-methyl-5-[(4-sulfamoylphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 167881522 |
| Molecular Formula | C14H17N3O4S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-methyl-5-[(4-sulfamoylphenyl)methylamino]benzenesulfonamide |
| SMILES | Cc1cc(NCc2ccc(S(N)(=O)=O)cc2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H17N3O4S2/c1-10-6-12(8-14(7-10)23(16,20)21)17-9-11-2-4-13(5-3-11)22(15,18)19/h2-8,17H,9H2,1H3,(H2,15,18,19)(H2,16,20,21) |
| InChIKey | QPLOGMNVOJCNRV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |