About 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide
3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide (PubChem CID 28541147) has the molecular formula C16H20N2O2S
and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide |
| PubChem CID | 28541147 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide |
| SMILES | Cc1cc(C)c(CNc2cccc(S(N)(=O)=O)c2)c(C)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-11-7-12(2)16(13(3)8-11)10-18-14-5-4-6-15(9-14)21(17,19)20/h4-9,18H,10H2,1-3H3,(H2,17,19,20) |
| InChIKey | REKHYUZZHBNLQE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide?
The IUPAC name of 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide (CID 28541147) is 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide.
What is the SMILES notation for 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide?
The canonical SMILES for 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide is Cc1cc(C)c(CNc2cccc(S(N)(=O)=O)c2)c(C)c1.
What is the InChIKey of 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide?
The InChIKey is REKHYUZZHBNLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2S/c1-11-7-12(2)16(13(3)8-11)10-18-14-5-4-6-15(9-14)21(17,19)20/h4-9,18H,10H2,1-3H3,(H2,17,19,20).
What are the key properties of 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide?
3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide has a molecular weight of 304.42 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4,6-trimethylphenyl)methylamino]benzenesulfonamide is sourced from PubChem (CID 28541147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).