C13H13ClN2O3S — CID 115950963
3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide (PubChem CID 115950963) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is 3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 115950963 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NCc2cccc(Cl)c2O)c1 |
| InChI | InChI=1S/C13H13ClN2O3S/c14-12-6-1-3-9(13(12)17)8-16-10-4-2-5-11(7-10)20(15,18)19/h1-7,16-17H,8H2,(H2,15,18,19) |
| InChIKey | UGDMHLNNNDVGEW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|