C13H12BrFN2O2S — CID 103579679
3-[(2-bromo-5-fluorophenyl)methylamino]benzenesulfonamide (PubChem CID 103579679) has the molecular formula C13H12BrFN2O2S and a molecular weight of 359.22 g/mol. Its IUPAC name is 3-[(2-bromo-5-fluorophenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-[(2-bromo-5-fluorophenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 103579679 |
| Molecular Formula | C13H12BrFN2O2S |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 3-[(2-bromo-5-fluorophenyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NCc2cc(F)ccc2Br)c1 |
| InChI | InChI=1S/C13H12BrFN2O2S/c14-13-5-4-10(15)6-9(13)8-17-11-2-1-3-12(7-11)20(16,18)19/h1-7,17H,8H2,(H2,16,18,19) |
| InChIKey | AQJJNWMVVAFFTK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |