C7H8BrFN2O2S — CID 112686127
1-bromo-4-fluoro-2-[(sulfamoylamino)methyl]benzene (PubChem CID 112686127) has the molecular formula C7H8BrFN2O2S and a molecular weight of 283.12 g/mol. Its IUPAC name is 1-bromo-4-fluoro-2-[(sulfamoylamino)methyl]benzene.
| Compound Name | 1-bromo-4-fluoro-2-[(sulfamoylamino)methyl]benzene |
|---|---|
| PubChem CID | 112686127 |
| Molecular Formula | C7H8BrFN2O2S |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 1-bromo-4-fluoro-2-[(sulfamoylamino)methyl]benzene |
| SMILES | NS(=O)(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C7H8BrFN2O2S/c8-7-2-1-6(9)3-5(7)4-11-14(10,12)13/h1-3,11H,4H2,(H2,10,12,13) |
| InChIKey | NBCZFGQHEZDZAX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |