C12H17BrFNO2S — CID 97102271
(2R)-N-[(2-bromo-5-fluorophenyl)methyl]-4-methylsulfonylbutan-2-amine (PubChem CID 97102271) has the molecular formula C12H17BrFNO2S and a molecular weight of 338.24 g/mol. Its IUPAC name is (2R)-N-[(2-bromo-5-fluorophenyl)methyl]-4-methylsulfonylbutan-2-amine.
| Compound Name | (2R)-N-[(2-bromo-5-fluorophenyl)methyl]-4-methylsulfonylbutan-2-amine |
|---|---|
| PubChem CID | 97102271 |
| Molecular Formula | C12H17BrFNO2S |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | (2R)-N-[(2-bromo-5-fluorophenyl)methyl]-4-methylsulfonylbutan-2-amine |
| SMILES | C[C@H](CCS(C)(=O)=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C12H17BrFNO2S/c1-9(5-6-18(2,16)17)15-8-10-7-11(14)3-4-12(10)13/h3-4,7,9,15H,5-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | UGOPMYXSMUMRGC-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |