C13H14N2O5S — CID 107730329
3-[(2,3,4-trihydroxyphenyl)methylamino]benzenesulfonamide (PubChem CID 107730329) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 3-[(2,3,4-trihydroxyphenyl)methylamino]benzenesulfonamide.
| Compound Name | 3-[(2,3,4-trihydroxyphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 107730329 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-[(2,3,4-trihydroxyphenyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NCc2ccc(O)c(O)c2O)c1 |
| InChI | InChI=1S/C13H14N2O5S/c14-21(19,20)10-3-1-2-9(6-10)15-7-8-4-5-11(16)13(18)12(8)17/h1-6,15-18H,7H2,(H2,14,19,20) |
| InChIKey | HLOTXMNOPBHICP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|