C16H19NO4 — CID 107730994
4-[[3-(3-hydroxypropyl)anilino]methyl]benzene-1,2,3-triol (PubChem CID 107730994) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[[3-(3-hydroxypropyl)anilino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[3-(3-hydroxypropyl)anilino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 107730994 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-[[3-(3-hydroxypropyl)anilino]methyl]benzene-1,2,3-triol |
| SMILES | OCCCc1cccc(NCc2ccc(O)c(O)c2O)c1 |
| InChI | InChI=1S/C16H19NO4/c18-8-2-4-11-3-1-5-13(9-11)17-10-12-6-7-14(19)16(21)15(12)20/h1,3,5-7,9,17-21H,2,4,8,10H2 |
| InChIKey | YJJXVDZMHSASMY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|